How do you solve the 4th problem? 视图登录只共章宋体ES A AAa- |や空囚m、而,, x.4|AaBbC AaBI AaBbC粘贴BIU- abe x, xA-空,A.A 前加, 、田。标導标題1选择。剪贴板 r字体样式4. Which of the following coordination ions is low spin?(A) [Fe(H,O).* (B) [Co(H,O)«]* (C) [FeF]* (D) [CoF] *3-5.Which coordination ion could be called chelate?(A) [Cr(NH3)6]-(BỊ [Fe(C204):}(C) [AIF6]-(D) [Ni(NH;)4F*6. Which of the following coordination compounds has tetrahedral shape?| (A) [Ni(CN)4] (B) [Pt(NH3);] (C) [Ni(NH3)4]2* (D) [Cu(C;O)2]

By using the spectrochemical series , we can see the strong field and weak field ligand . On the…

Answered: 4. Which of the following coordination…

Science

Chemistry

4. Which of the following coordination ions is low spin? CA) [Fe(H,O).J* (B) [Co(H;O)]" (c) [FeF«]* (D) [CoF]*

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter20: Chemistry Of Selected Transition Elements And Coordination Compounds

Section: Chapter Questions

Problem 116QRT

See similar textbooks

Related questions

Q: Give the systematic name for the following coordination compound: K₂[CrCO(CN)₅]

A: In the given coordination compound the cation is K+ and the anion is complex [CrCO(CN)₅]2-. The…

Q: 2. The [Co(NH3)6]²+ complex is high spin, the [Co(NH3)6]³+ complex is low spin. Which complex is…

Q: Give the systematic name for the following coordination compound or complex ion: [Co(NH,),Br]SO,

Q: Indicate the coordination number and the oxidation num- ber of the metal for each of the following…

A: The oxidation of central metal atoms of given coordination compounds are calculated as,

Q: The molar mass of the coordination compound [M(NH3)4Cl2]Cl is 304.1 g/mol and the atomic mass of…

Q: Which complex ion includes a bond angle of 107°? A [Cr(NH;),J** B [CuCl,] C [CuClj?- D [Cr(H,O),1*

A: The Complex [CuCl4]2- exists in a discrete tetrahedral shape. Its crystal structure is taken from…

Q: In 2001, chemists at SUNY-Stony Brook succeeded in syn-thesizing the complex trans-[Fe(CN)4(CO)2]2-,…

A: The compounds where metal ion is the central metal and molecules that can share their electron with…

Q: Its magnetic moment is 4.0 B.M. Are the Co-O bond lengths the same in the six-coordinated…

Q: Name the following coordination entities and draw the structures of their stereoisomers :(i)…

A: Nomenclature of Coordination entries involves the oxidation states of the central atom. Oxidation…

Q: A complex is written as NiBr2 . 6 NH3. (a) What is the oxidationstate of the Ni atom in this…

A: (a) The given compound is [Ni(NH3)6]Br2 Oxidation number is the total number of electrons an atom…

Q: Consider the following coordination compound: [CoCl(NH3)4(H2O)]SO4- What is its formula and…

A: A question based on coordination complex, which is to be accomplished.

Q: A complex is written as NiBr2 . 6 NH3. What is the likely coordination number for the complex?

A: The complex given is written as [Ni (NH3)6] Br2. The coordination number is given by the ligands…

Q: For the low spin coordination compound [Fe(en)2Cl]Cl, identify the Oxidation number of iron

A: Note : I think the complex should [Fe(en)2Cl2]Cl. So I'm giving answer for both the complex.

Q: The coordination compounds which is Enzymes- Carbonic Anhydrase. a. The oxidation number of central…

A: Carbonic Anhydrase is an enzyme i.e. utilize for the conversion of carbon dioxide to carbonic acid .…

Q: • Name these coordination complexes: •a. Cr(NH3);Cl3 •b. Pt(en)Cl, • . [Pt(ox),]? а. С.

A: a. Given, Cr(NH3)3Cl3 Name => Triamminetrichloridochromate(III)

Q: Which antioxidant complex formed by Cu(I)-Nc chelate makes it possible to determine its lower…

A: Antioxidants are compounds produced in body and found in foods. They help defend our cells from…

Q: What was the color of solid Ka(Al(C204)3] complex?

A: P otassium trisoxalato aluminate(III) is a white crystalline solid.

Q: A chemist synthesizes two coordination compounds. One compound decomposes at 280°C, the other at…

Q: What is the total spin number, S, for (Fe(CN)J3 complex?

A: d-orbital is composed of five orbitals and each orbital can have a maximum of two electrons. So…

Q: the coordination compound Rb2[Cr(O)Cls] (one oxide ligand and five chloride ligands). a. Determine…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: If one mole of PtCl4-5NH3 reacts with AgNO, to produce three moles of AgCl(s), how can the formula…

A: The molecular formula of the given coordination compound is = PtCl4.5NH3 The coordination sphere in…

Q: Three bottles of aqueous solutions are discovered in an aban- doned lab. The solutions are green,…

A: To Find: To determine the likely identity of each of the colored solutions of the three complex ions…

Q: Complete the structure for the trans-diamminedichloridoplatinum(II) coordination complex. Also,…

A: Given structure is :

Q: Determination of %NH3 in the coordination compound with the empirical formula: Cr,(NH3),CI, 1) A…

A: To determine the percentage of ammonia present in coordination compound with the empirical…

Q: Give the systematic name for the following coordination compound or complex ion:…

A: Naming of coordination compound 1. In coordination compound always write the name of cation before…

Q: The molar mass of the coordination compound [M(NH3)4Cl2]Cl is 381.5 g/mol and the atomic mass of…

Q: Consider the coordination compound [Ni(C204)2(H20)2]Cl2 and identify ligands O a. H20, CI- O b. C204…

Q: In 2001, chemists at SUNY-Stony Brook succeeded in syn-thesizing the complex trans-[Fe(CN)4(CO)2]2-,…

A: Oxidation state of CN- = -1 Oxidation state of CO = 0 Calculation of oxidation state of Fe in the…

Q: A coordination compound of ruthenium, [Ru(NH3)4Cl2]Cl, has shown some activity against leukemia in…

A: Generally in a coordination complex, a central metal atom (usually transition metal) is bonded to…

Q: Give the systematic name of this coordination compound. Co(NH,),Cl,: triamminetrichlorocolbalt (III)…

A: The nomenclature of inorganic complexes is done according to the following rules: a) The name of the…

Q: Which of the following pairs are coordination isomers? a. [Pt Br2Cl2(H20)2]CO3 and [PtBr2Cl2]CO3…

A: Correct answer about coordination isomerism is given below.

Q: SAIC Ex7.1 Name and draw structures of the following complexes: a) [Ni(CO)4], b) [Ni(CN)4] , v)…

A: a) [Ni(CO)4] - Tetracarbonylnickel (0) b) [Ni(CN)4]2- - Tetracyanonickelate (II) ion c) [CoCl4]2-…

Q: What is the name of the coordination compound [Fe(en);(NO2);]Cl ?

Q: n the coordination complex [Cu(H,0)4F, each water molecule plays the role of a nter the comect word…

Q: During the dissociation process, ligand is dissociated from the [RHCI(OX)(en)(PPH3)] octahedral…

A: In a dissociation mechanism, a ligand is removed from the complex.

Q: Name the following coordination entities and describe their structures :(i) [Fe(CN)6]4-(ii)…

A: 1) FeCN64- IUPAC name - There are 6 cyanide groups present . The oxidation state of Fe here is +2.…

Q: Which complex has the highest coordination number? a) K3[Cr(CN)4] b) [Ni(bpy)2en]2+ c)…

A: Answer - The correct option is (B) [Ni(bpy)2en]2 complex has the highest coordination number…

Q: Which coordination complex has the greatest A,? O [ScI,j³- O [Sc(NH,),J³+ O [Sc(H,O),J³* O…

A: Given Complex = [ ScI6 ]3- , [ Sc ( NH3 )6 ]3+ , [ Sc( H2O)6 ]3+ , [ Sc ( en )3 ]3+ ∆0 = ?

Q: Let us consider the following coordination complexes: [Fe(CN6)]3- what is the name of these…

A: Name: hexacyanoferrate (III)

Q: Consider the coordination compound [Ni(C₂O4)2(H₂O)2] Cl2 and identify ligands a. C₂04-2, CI- -2 O b.…

Q: You are synthesizing a coordination complex using the following reaction: FeCl3 + 3K₂C₂O4 H₂O →…

A: The given reaction is as follows; FeCl3+ 3K2C2O4.H2O → K3Fe(C2O4)3.3H2O +KCl Also it is given that;…

Q: 5. Which coordination ion could be called chelate? (A) [Cr(NH)]- (B) [Fe(C;O4);]° (C) [AIF3- (D)…

Q: What is the formula for the coordination compound hexaaquairon(III) chloride? A) [Fe(H,O),J** B)…

A: Oxidation state of iron should be +3 . Aqua is used for H2O . Only H2O is inside coordination sphere…

Q: Coordination complexes

A: In this question we have to explain that the following statement is true or false, coordination…

Q: Give the IUPAC name for this coordination compound. [Cr(H, O),CIJSO4

A: Write IUPAC name of the given coordination compound-

Q: Name the following complex ions. formula [Ti(OH)] [Fe(CO₂),] name 0

A: The answer is given below:

Q: Which coordination complex has the greatest A,? O [Co(en), 1*+ O [COBB,- O [Co(NH3),1³+ O…

A: Applying concept of factors affecting splitting factor ∆o and spectrochemical series.

Q: Question attached

A: The given Coordination compound is Cr(bpy)2(CO)2 To find: The oxidation state and d-configuration…

Q: In (nº-Cp)Fe(CO),CI, how many coordination sites are occupied by the Cp ligand? * O 1 O 2 O 4 O 5 In…

A: 1. η5-Cp is a six-electron ligand . Because Cp piles on electrons, the numbers of ligands bound to…

Q: Consider the coordination compound [Cr(H,O),Cl]CI and calculate the the coordination number of the…

A: Coordination number: Coordination number of a metal ion in a complex can be define as the number of…

Concept explainers

Analytical Tools

Analytical tools or analysis tools help one to get into a conclusion or results from the data collected. Analytical tools can be applied for simple data sets and also in the case of big data analytics.

Question

How do you solve the 4th problem?

视图
登录只共章
宋体
ES A A
Aa- |や空囚m、而,, x.4|
AaBbC AaBI AaBbC
粘贴
BIU- abe x, x
A-空,A.A 前加, 、田。
标導
标題1
选择。
剪贴板 r
字体
样式
4. Which of the following coordination ions is low spin?
(A) [Fe(H,O).* (B) [Co(H,O)«]* (C) [FeF]* (D) [CoF] *
3-
5.
Which coordination ion could be called chelate?
(A) [Cr(NH3)6]-
(BỊ [Fe(C204):}
(C) [AIF6]-
(D) [Ni(NH;)4F*
6. Which of the following coordination compounds has tetrahedral shape?
| (A) [Ni(CN)4] (B) [Pt(NH3);] (C) [Ni(NH3)4]2* (D) [Cu(C;O)2]

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Basic

VIEW

Low spin complex

VIEW

Answer

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Determine the type of hybrid orbitals and the spatial structure of the following two complexes. A) [Fe〖(H_2 O)〗_6 ]^(3+) μs=5.92 B.M. B) [Fe〖(CN)〗_6 ]^(3+) μs=1.73 B.M.
A method different from the method of Job to determine the coordination number of a complex is to measure the shift in polarographic half-wave potential Ex of a metal ion M²* to more negative values during complex formation as a function of the concentration of the added ligand L. A good example is complex formation between Cd²+ and NH3 to which the equation E-(E), = 0.0591 2 [NH3J/mol L-1 0 Ey/V log [NH3] {Ex-(Ex)s}/V n= applies, where (E₁), is the half-wave potential of the free Cd²+ metal ion (i.e. in the absence of the ligand NH3), and K and n, as before, are the formation constant and coordination number of the resulting complex Cd (NH3)², respectively. Use the tabled values below and the supplied graph paper to determine the coordination number and molecular formula of the complex by plotting E-(E), versus log[NH3] and calculating n from the slope of the straight line graph. formula: 0.0592 2 log K-n- -log[NH,] -0.752 3.14 -0.840 3.86 -0.856 4.75 -0.872 7.20 -0.904 8.86 -0.920
Calculate ∆ in kJ/mol if a d1 complex has an absorption maximum at 545 nm.
3. (c)) Fe(CN),]³- exhibits two sets of charge transfer absorptions in visible and ultraviolet region but [Fe(CN),]*¯ shows 11 only one absorption in the ultraviolet region. Explain.
When compared to that of the free thiourea, the vibrational frequency of carbon-sulfur bond in (Cu(tu)3]^+ complex is: 1 a. lower b. the same c. none of these d. higher If the molar susceptibility of the unpaired electrons of the polar complex Ni(PPH3)2C12 was found to be 3.4 x 10-3 c.g.s. at 25 C. Then the molecular geometry of this complex is: 2 a. Tetrahedral b. trans-Square planar c. trans-Octahedral d. cis-Square planar The complexes you prepared in optical isomerism experiment are: a. [Co(NH3)6]C13 and [Co(NH3)3(NO2)3] b. Cis- and trans-[Co(en)2C12]^+ c. (+)[Co(en)3]^3+ and (-)[Co(en)3]^3+ d. [Co(NH3)4CO3]NO3 and [Co(NH3)5CI]C12
The crystal field stabilization energy and magnetic moment (spin only)of an octahedral aqua complex of a metal ion (M\power{z+}) are -0.8 Δ\index{0} and 3.87 BM, respectively . identify (M\power{z+}).
Which of the following pairs are coordination isomers? a. [Pt Br2Cl2(H20)2]CO3 and [PtBr2Cl2]CO3 2H20 b. [Cr(H,0)a][PtCla] and [PtCl,(H,0)2][C•CI,(H,0)2] C. None of the choices |d. [PtCl4(H2O)2]Cl2 and [PtCl3(H20)2]Cl3
Potentially Useful Information Spectrochemical Series: | < Br < SCN < Cl° < NO3¯< F° < OH° < C2O4²- ~ H2O < NCS < NH3 < en < PPH3 A student synthesizes and isolates the following coordination compound [Ni(H2NCH2CH2NH2)3]Cl2 (molar mass = 309.8966 g/mol) according to the balanced reaction below. In the experiment, the student reacts 2.500 g of nickel (II) chloride hexahydrate (molar mass = 237.6878 g/mol) with 4.000 g of ethylenediamine (molar mass = 60.0992 g/mol). After isolating the product, the student collects 3.200 g of the nickel coordination compound. NICI2•6H2O (aq) + 3H2NCH2CH2NH2 (1) → [Ni(H2NCH2CH2NH2)3]Cl2 (s) + 6H2O (1) Given the transition metal compound, Na4[Co(C204) (CN)4], what is the oxidation state of cobalt, as well as the coordination number of cobalt in this compound? This compound is soluble in water. The oxidation state of cobalt is Cobalt has a coordination number of Your answer should be an integer.
Potentially Useful Information Spectrochemical Series: | < Br < SCN < Cl° < NO3¯< F° < OH° < C2O4²- ~ H2O < NCS < NH3 < en < PPH3 A student synthesizes and isolates the following coordination compound [Ni(H2NCH2CH2NH2)3]Cl2 (molar mass = 309.8966 g/mol) according to the balanced reaction below. In the experiment, the student reacts 2.500 g of nickel (II) chloride hexahydrate (molar mass = 237.6878 g/mol) with 4.000 g of ethylenediamine (molar mass = 60.0992 g/mol). After isolating the product, the student collects 3.200 g of the nickel coordination compound. NICI2•6H2O (aq) + 3H2NCH2CH2NH2 (1) → [Ni(H2NCH2CH2NH2)3]Cl2 (s) + 6H2O (1) What is the limiting reactant in the reaction above? In this reaction, the limiting reactant is... O ethylenediamine O nickel (II) chloride hexahydrate O This reaction is stoichiometric, so there is no limiting reactant.
Would the coordination step between Br- and (CH3)3C+ be allowed if Br- were to approach from within the plane of the central C? Explain.
= MnAs has the hexagonal NiAs-type structure, a = 3.72 A and C 5.71 Å. can you calculate both (a) Mn - As distance, and (b) two Mn - Mn distances, and (c) As - As distance, and (d) coordination environments of Mn and As