Chemistryneed help with 5 and 6. Drawand PrintOR5. Using rule 'like dissolves like" identify pairs of substances that are expected to be miscibleA Font Color AutoSavePredictions On(0)(b)(0)H.CedipoleH.C10 CONwridendeEthanol is polarMethanol is polarAcetonitrile is polarCF/CHF; in polarH.C.HHCit dipuleH.C6. Rank the interactions from weakest to strongest:a. H₂O --OH, name of IMFb. Li --Fname of IMFc. Li-OH,name of IMFner dipole0CH₂CHCHCHDiethyl ether in polarMethylamine is polarAcetone is polarPentane is nonpolarBFocus 1000

Like dissolve like rule is that if any substance is polar than any polar and ionic substance will…

nd Print Font Color AutoSave 5. Using rule 'like dissolves like" identify pairs of substances that are expected to be miscible (0) (d) H.C H..C.. Ethanol is polar Methanol in polar Acetonitrile is polar CF/CHF; is polar H H.C. L.C. ndipole CH H₂ CH CH Diethyl ether is polar Methylamine is polar Acetone is polar Pentane is noepolar

nd Print Font Color AutoSave 5. Using rule 'like dissolves like" identify pairs of substances that are expected to be miscible (0) (d) H.C H..C.. Ethanol is polar Methanol in polar Acetonitrile is polar CF/CHF; is polar H H.C. L.C. ndipole CH H₂ CH CH Diethyl ether is polar Methylamine is polar Acetone is polar Pentane is noepolar

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter7: Molecular Structures

Section: Chapter Questions

Problem 88QRT

See similar textbooks

Similar questions

The sugar fructose contains 40.0% C, 6.7% H, and 53.3% O by mass. A solution of 11.7 g of fructose in 325 g of ethanol has a boiling point of 78.59 C. The boiling point of ethanol is 78.35 C, and Kb for ethanol is 1.20 C/m . What is the molecular formula of fructose?
Which of the following would be expected to form hydrogen bonds with water? CH3 3-chloro-3-methylpentane CH,CH,CCH,CH3 CI | H. H. H- cyclobutane H -H H H H. H methyl propanoate H- ·C -H
Solubility- hexachlorobenzene Q1)Using the Lewis structures of the molecule and water, identify and label areas of intermolecular attraction. ▪More than one water molecule should be shown ▪Label the type of IM forces present b)Using the Lewis structures of the molecule and a nonpolar solvent (e.g., hexane), identify and label areas of intermolecular attraction. c)explain the solubility (or lack thereof) of your molecule in water. When available, use solubility data (at the same temperature) to support your explanation. d)explain the solubility (or lack thereof) of your molecule in nonpolar solvents. When available, use solubility data (at the same temperature) to support your explanation. e)when dissolved in water, qualitatively discuss whether the molecule is a strong electrolyte, weak electrolyte, or nonelectrolyte. Please answer very soon will give rating surely All questions answers needed
n.google.com/0/c/Mzka Open with Google Docs Directions: ldentify the most probable Intermolecular force of attraction in the following; 1. KCI -KCI 2. NH3-NH3 3. Nazs Nazs 4. HF-HF 5. MgS Mgs 6. CH3OH- -CH3OH 7. H2H2 8. CuO- -CuO 9. S6H3- SbH3 10. CO2- -CO2 II. Directions: Describe the relationship of the following properties with intermolecular forces of attraction. Choose only two properties. a. Boiling point/ evaporation b. Surface tension C. Capillary action d. Convex and concave meniscus e. viscosity ctiv 14 15 Q + o to Page
more aqueous. How hydrogen yond, 5. Both oxygen atoms in acetic acid (CH3CO₂H) are capable of hydrogen bonding, a feature that contributes greatly to the high boiling point of pure acetic acid. In water This also acetic acid Ce molecules hydrogen bond with water molecules, a factor which increases the solubility of linos acetic acid in water. Depict all possible hydrogen bonds between water molecules and each oxygen of a molecule of acetic acid. Use a dotted line to highlight each hydrogen bond. Which atom on a water molecule will be attracted to an oxygen atom on acetic acid? Why? HTC-H H-C-C Н Ö: n=0 Q-H Lab Notes Embed a copy of your lab notes for this experiment at the end of your report.
Rank the following from strongest intermolecular attraction to weakest intermolecular attraction. Strongest IM attraction v [ Choose ] C5H12 with itself 2nd strongest IM attraction KF with water CH4 with itself PH3 with itself 3rd strongest IM attraction NH3 with itself 4th strongest IM attraction [Choose] 5th strongest (weakest) IM attraction ( Choose )
40. Which of the following is not a polar protic solvent? :0: H | || H :0: H I || | Н-с-с-с-н н-с-ӧ-н н-ӧ-н н-с-с-ӧ-н .. H H A D
Which compound would you expect to be more soluble in water, CH4 or NH3? Explain.
Part A Which of the following likely to be more soluble in hexane, C6H14? Explain your answer in each case. Match the items in the left column to the appropriate blanks in the sentences on the right. hydrogen bonding dispersion forces acetic acid ionic bonds octanoic acid benzene glycerol CaCl₂ CC14 is more soluble, because Among CCl4 and CaCl2, are less likely to be overcome by solute-solvent interactions. Among benzene (C6H6) and glycerol (CH₂(OH) CH(OH)CH₂ OH), soluble, because interaction. in in Among octanoic acid (CH3 (CH₂)6 COOH) and acetic acid (CH3 COOH), more soluble, because it has similar to those in hexane. Reset is more is less likely to be overcome by solute-solvent will be Help
Classify the following solvent. ○ polar, aprotic Ononpolar, protic ○ polar, protic ○ nonpolar, aprotic OH
1) CI (1 equiv) cat. AICI3 2) HNO3, cat. H2SO4 CI
2. Arrange the following compounds in terms of increasing boiling point. |- Isopentanoic acid II - Pentanoic Acid III - Diethylketone IV - Pentanal A. I, II, III, IV B. IV, II, II, I C. II, IV, I, II D. II, III, I, IV